CAS 528531-90-0

N-[4-bromo-2-(propan-2-yl)phenyl]-2-(4-ethylphenoxy)acetamide

Description:

N-[4-bromo-2-(propan-2-yl)phenyl]-2-(4-ethylphenoxy)acetamide is a synthetic organic compound characterized by its complex structure, which includes a brominated phenyl group, an isopropyl substituent, and an ethoxyphenyl moiety. This compound features an acetamide functional group, which contributes to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. The isopropyl group adds steric bulk, potentially affecting the compound's interaction with biological targets. The ethylphenoxy group may enhance lipophilicity, influencing solubility and permeability. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific interactions and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity associated with its functional groups.

Formula: C₁₉H₂₂BrNO₂

InChI: InChI=1/C19H22BrNO2/c1-4-14-5-8-16(9-6-14)23-12-19(22)21-18-10-7-15(20)11-17(18)13(2)3/h5-11,13H,4,12H2,1-3H3,(H,21,22)

SMILES: CCc1ccc(cc1)OCC(=Nc1ccc(cc1C(C)C)Br)O

Synonyms:

• acetamide, N-[4-bromo-2-(1-methylethyl)phenyl]-2-(4-ethylphenoxy)-
• N-(4-bromo-2-isopropylphenyl)-2-(4-ethylphenoxy)acetamide

N-(4-bromo-2-isopropylphenyl)-2-(4-ethylphenoxy)acetamide

CAS: 528531-90-0

Formula: C₁₉H₂₂BrNO₂

Purity: 95.0%

Molecular weight: 376.294

Ref: 10-F315322