CAS 528565-79-9
:(2S,5S,2'S,5'S)-1,1'-ethane-1,2-diylbis(2,5-diphenylphospholane)
Description:
The chemical substance known as "(2S,5S,2'S,5'S)-1,1'-ethane-1,2-diylbis(2,5-diphenylphospholane)" with CAS number 528565-79-9 is a complex organophosphorus compound characterized by its unique stereochemistry and structural features. This compound contains two phospholane rings, which are five-membered cyclic compounds containing phosphorus, and are substituted with phenyl groups that enhance its stability and reactivity. The presence of multiple stereocenters contributes to its chiral nature, which can influence its interactions in various chemical environments. Such compounds are often studied for their potential applications in catalysis, particularly in asymmetric synthesis, due to their ability to stabilize transition states and facilitate selective reactions. Additionally, the presence of the ethane-1,2-diyl linker connects the two phospholane units, potentially affecting the compound's overall conformation and reactivity. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both synthetic and theoretical chemistry.
Formula:C34H36P2
InChI:InChI=1/C34H36P2/c1-5-13-27(14-6-1)31-21-22-32(28-15-7-2-8-16-28)35(31)25-26-36-33(29-17-9-3-10-18-29)23-24-34(36)30-19-11-4-12-20-30/h1-20,31-34H,21-26H2/t31-,32-,33-,34-/m0/s1
SMILES:c1ccc(cc1)[C@@H]1CC[C@@H](c2ccccc2)P1CCP1[C@@H](CC[C@H]1c1ccccc1)c1ccccc1
Synonyms:- (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane
- (+)-1,2-Bis((2S,5S)-2,5-diphenylphospholano)ethane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, 95%
CAS:It is used as ligands like DuPhos and BPE ligands and are highly efficient privileged ligands. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar produFormula:C34H36P2Purity:95%Color and Shape:White, Powder or crystals or crystalline powderMolecular weight:506.61(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, min. 95% (R,R)-Ph-BPE
CAS:(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, min. 95% (R,R)-Ph-BPE
Formula:(C16H16)PCH2CH2P(C16H16)Purity:min. 95%Color and Shape:white solidMolecular weight:506.60(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane
CAS:Formula:C34H36P2Purity:98%Color and Shape:SolidMolecular weight:506.59721,2-BIS((2R,5R)-2,5-DIPHENYLPHOSPHOLAN-1-YL)ETHANE
CAS:Purity:95%Color and Shape:SolidMolecular weight:506.609985351563




