CAS 5286-10-2
:(13Z)-2'-hydroxy-4'',5''-dimethoxylythran-12-one
Description:
(13Z)-2'-hydroxy-4'',5''-dimethoxylythran-12-one, with the CAS number 5286-10-2, is a naturally occurring compound belonging to the class of alkaloids. This substance is characterized by its complex molecular structure, which includes multiple methoxy groups and a hydroxyl group, contributing to its chemical reactivity and potential biological activity. The presence of the 13Z configuration indicates a specific geometric arrangement around a double bond, which can influence the compound's interactions with biological systems. Alkaloids like this one are often noted for their pharmacological properties, including potential anti-inflammatory, analgesic, or antimicrobial effects. The methoxy groups enhance the lipophilicity of the molecule, potentially affecting its solubility and permeability in biological membranes. Additionally, the compound may exhibit unique optical properties due to its stereochemistry. Overall, (13Z)-2'-hydroxy-4'',5''-dimethoxylythran-12-one represents a fascinating subject of study in both organic chemistry and pharmacology, with implications for drug development and natural product chemistry.
Formula:C26H29NO5
InChI:InChI=1/C26H29NO5/c1-30-24-14-19-20(15-25(24)31-2)22-13-18(12-17-5-3-4-10-27(17)22)32-26(29)9-7-16-6-8-23(28)21(19)11-16/h6-9,11,14-15,17-18,22,28H,3-5,10,12-13H2,1-2H3/b9-7-/t17-,18-,22-/m0/s1
Synonyms:- Lythran-12-one, 2'-hydroxy-4'',5''-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
