CAS 52868-67-4

5-amino-1-methyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxamide

Description:

5-Amino-1-methyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxamide, with the CAS number 52868-67-4, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a thioxo group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and interactions in biological systems. The methyl group attached to the imidazole ring can affect the compound's lipophilicity and solubility. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmaceutical research. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacological properties and mechanisms of action would be necessary to fully understand its potential uses.

Formula: C₅H₈N₄OS

InChI: InChI=1/C5H8N4OS/c1-9-3(6)2(4(7)10)8-5(9)11/h6H2,1H3,(H2,7,10)(H,8,11)

SMILES: Cn1c(c(C(=N)O)nc1S)N

5-Amino-2-mercapto-1-methyl-1H-imidazole-4-carboxamide

CAS: 52868-67-4

Formula: C₅H₈N₄OS

Molecular weight: 172.2082

Ref: IN-DA00DCYA

5-amino-2-mercapto-1-methyl-1H-imidazole-4-carboxamide

CAS: 52868-67-4

Formula: C₅H₈N₄OS

Purity: 95.0%

Molecular weight: 172.21

Ref: 10-F310257