CAS 528814-26-8

2-tert-butyl-1-[(1R)-2-tert-butylisophosphindolin-1-yl]isophosphindoline

Description:

2-tert-butyl-1-[(1R)-2-tert-butylisophosphindolin-1-yl]isophosphindoline is a complex organic compound characterized by its unique structural features, including multiple tert-butyl groups and isophosphindoline moieties. This compound belongs to a class of phosphorus-containing organic compounds, which often exhibit interesting chemical reactivity and potential applications in materials science and medicinal chemistry. The presence of the isophosphindoline framework suggests that it may possess specific stereochemical properties, particularly due to the chiral center indicated by the (1R) configuration. Such compounds can exhibit diverse biological activities, making them of interest in pharmaceutical research. Additionally, the bulky tert-butyl groups may influence the compound's solubility, stability, and interaction with other molecules. Overall, the characteristics of this substance, including its molecular structure and potential reactivity, make it a subject of interest for further study in various chemical and biological contexts.

Formula: C₂₄H₃₂P₂

InChI: InChI=1/C24H32P2/c1-23(2,3)25-15-17-11-7-9-13-19(17)21(25)22-20-14-10-8-12-18(20)16-26(22)24(4,5)6/h7-14,21-22H,15-16H2,1-6H3/t21-,22?,25?,26?/m1/s1

SMILES: CC(C)(C)P1Cc2ccccc2[C@@H]1C1c2ccccc2CP1C(C)(C)C

(1R,1'R,2S,2'S)-(+)-2,2'-Di-t-butyl-2,3,2',3'-tetrahydro-1,1'-bi-1H-isophosphindole, min. 98% (R,R,S,S)-DUANPHOS

CAS: 528814-26-8

(1R,1'R,2S,2'S)-(+)-2,2'-Di-t-butyl-2,3,2',3'-tetrahydro-1,1'-bi-1H-isophosphindole, min. 98% (R,R,S,S)-DUANPHOS

Formula: C₂₄H₃₂P₂

Purity: min. 98%

Color and Shape: white xtl.

Molecular weight: 382.46

Ref: 08-15-1060

(1R,1′R,2S,2′S)-DuanPhos

CAS: 528814-26-8

Formula: C₂₄H₃₂P₂

Molecular weight: 382.4584

Ref: IN-DA003BFX