CymitQuimica logo

CAS 52886-06-3

:

7H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-7-one

Description:
7H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-7-one, with the CAS number 52886-06-3, is a heterocyclic organic compound characterized by its complex fused ring structure, which includes a dioxole and pyrrole moiety integrated into a phenanthridine framework. This compound typically exhibits properties such as fluorescence, making it of interest in various applications, including organic electronics and photonic devices. Its unique structure may also confer biological activity, potentially leading to applications in medicinal chemistry. The presence of multiple heteroatoms in the ring system can influence its reactivity and solubility, affecting how it interacts with other chemical species. Additionally, the compound's stability and behavior under different conditions, such as pH and temperature, are crucial for its practical applications. Overall, 7H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-7-one represents a fascinating subject of study in the fields of organic synthesis and materials science.
Formula:C16H9NO3
InChI:InChI=1S/C16H9NO3/c18-16-12-7-14-13(19-8-20-14)6-11(12)10-3-1-2-9-4-5-17(16)15(9)10/h1-7H,8H2
InChI key:InChIKey=DONUVZIVKLIMJU-UHFFFAOYSA-N
SMILES:O=C1N2C=3C(C=4C1=CC5=C(C4)OCO5)=CC=CC3C=C2
Synonyms:
  • Hippadine
  • NSC 624783
  • NSC 329494
  • 7H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-7-one
  • Pratorine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.