CAS 529-05-5
:Chamazulene
Description:
Chamazulene is a naturally occurring organic compound classified as a sesquiterpene, primarily known for its deep blue color. It is derived from the essential oils of certain plants, particularly those in the Asteraceae family, such as chamomile. Chemically, chamazulene is characterized by its unique bicyclic structure, which contributes to its aromatic properties. It exhibits anti-inflammatory, antioxidant, and antimicrobial activities, making it of interest in both pharmacological and cosmetic applications. The compound is relatively stable under normal conditions but can be sensitive to light and air, which may lead to degradation. Chamazulene is often used in formulations for its soothing effects on the skin and is valued in traditional medicine for its potential therapeutic benefits. Its CAS number, 529-05-5, is a unique identifier that facilitates the identification and study of this compound in scientific literature and regulatory contexts. Overall, chamazulene is notable for its distinctive color, biological activity, and applications in various fields.
Formula:C14H16
InChI:InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3
InChI key:InChIKey=GXGJIOMUZAGVEH-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC1)C(C)=CC=C(CC)C2
Synonyms:- 1,4-Dimethyl-7-ethylazulene
- Azulene, 7-ethyl-1,4-dimethyl-
- Ba 2784
- Camazulene
- Chamazulen
- Chamazulene
- Dimethulen
- Dimethulene
- 7-Ethyl-1,4-dimethylazulene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Chamazulen
CAS:Chamazulen analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C14H16Purity:(HPLC) ≥95%Color and Shape:OilMolecular weight:184.28Chamazulene
CAS:Aromatic hydrocarbonFormula:C14H16Purity:≥ 95.0 % (GC)Color and Shape:Oily liquidMolecular weight:184.28Chamazulene
CAS:Chamazulene is an aromatic chemical compound that functions as a natural anti-inflammatory agent, which is derived from the essential oil of chamomile flowers (Matricaria recutita and Chamaemelum nobile). This compound is primarily formed during the steam distillation of the chamomile plant, where precursors such as matricin undergo chemical transformation.Formula:C14H16Purity:Min. 95 Area-%Color and Shape:Blue Clear LiquidMolecular weight:184.28 g/molChamazulene
CAS:Chamazulene (Dimethulene) is a terpenoid obtained from Matricaria chamomilla. It possesses anti-inflammatory and antioxidant activity, inhibits leukotriene B4.Formula:C14H16Purity:98%Color and Shape:SolidMolecular weight:184.28





