CAS 529-27-1
:(2-Methylphenyl)hydrazine
Description:
(2-Methylphenyl)hydrazine, also known as o-tolylhydrazine, is an organic compound characterized by the presence of a hydrazine functional group attached to a methyl-substituted phenyl ring. Its molecular formula is C8H10N2, indicating it contains eight carbon atoms, ten hydrogen atoms, and two nitrogen atoms. This compound typically appears as a colorless to pale yellow liquid with a distinct amine-like odor. It is soluble in organic solvents but has limited solubility in water. (2-Methylphenyl)hydrazine is known for its reactivity, particularly in forming azo compounds and as a potential intermediate in the synthesis of various pharmaceuticals and agrochemicals. However, it is also recognized for its toxicity and potential carcinogenic properties, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. Its applications extend to the field of organic synthesis, where it serves as a building block for more complex molecules.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-6-4-2-3-5-7(6)9-8/h2-5,9H,8H2,1H3
InChI key:InChIKey=SCZGZDLUGUYLRV-UHFFFAOYSA-N
SMILES:N(N)C1=C(C)C=CC=C1
Synonyms:- (2-Methylphenyl)hydrazine
- 2-Tolylhydrazine
- Hydrazine, (2-methylphenyl)-
- Hydrazine, o-tolyl-
- o-Methylphenylhydrazine
- o-Tolylhydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
