CAS 529-53-3
:Scutellarein
Description:
Scutellarein, with the CAS number 529-53-3, is a flavonoid compound primarily found in various plants, particularly in the genus Scutellaria, which is known for its medicinal properties. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and neuroprotective effects, making it of interest in pharmacological research. Scutellarein is characterized by its flavone structure, which consists of a chromone backbone with hydroxyl groups that contribute to its reactivity and biological activity. It is typically soluble in organic solvents and has limited solubility in water. The compound has been studied for its potential therapeutic applications, including its role in modulating cellular signaling pathways and its effects on various diseases. Additionally, scutellarein's safety profile and pharmacokinetics are subjects of ongoing research, as understanding these aspects is crucial for its potential use in herbal medicine and dietary supplements.
Formula:C15H10O6
InChI:InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H
InChI key:InChIKey=JVXZRQGOGOXCEC-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=C(O)C=C3)=CC(O)=C(O)C2O
Synonyms:- 2-(4-Hydroxyphenyl)-5,6,7-tris(oxidanyl)chromen-4-one
- 4',5,6,7-Tetrahydroxyflavone
- 4H-1-Benzopyran-4-one, 5,6,7-trihydroxy-2-(4-hydroxyphenyl)-
- 4′,5,6,7-Tetrahydroxyflavone
- 5,6,7,4′-Tetrahydroxyflavone
- 5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
- 6-Hydroxyapigenin
- Flavone, 4′,5,6,7-tetrahydroxy-
- Scutellarein
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
Scutellarein
CAS:Scutellarein analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H10O6Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:286.245,6,7-Trihydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-One
CAS:5,6,7-Trihydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-OnePurity:98%Molecular weight:286.24g/molScutellarein
CAS:Formula:C15H10O6Purity:(HPLC) ≥ 98.0%Color and Shape:Yellow powderMolecular weight:286.24Scutellarein
CAS:Scutellarein has antioxidant, antitumor, anti-adipogenic, antiviral and anti-inflammatory activities, it can improve neuronal injury, has better protective effect in rat cerebral ischemia. Scutellarein may serve as a SARS-CoV chemical inhibitor, it also exerts strong inhibition towards the tested UDP-glucuronosyltransferase isoforms.Formula:C15H10O6Purity:95%~99%Molecular weight:286.239Scutellarein
CAS:Formula:C15H10O6Purity:>95.0%(HPLC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:286.24Scutellarein
CAS:Scutellarein (6-Hydroxyapigenin) reduces inflammatory responses by inhibiting Src kinase activity.Formula:C15H10O6Purity:98.02% - 99.63%Color and Shape:SolidMolecular weight:286.24Ref: TM-T3319
2mg40.00€5mg56.00€10mg80.00€25mg115.00€50mg167.00€100mg240.00€200mg356.00€1mL*10mM (DMSO)63.00€Scutellarein
CAS:Oxygen-heterocyclic compoundFormula:C15H10O6Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:286.24Scutellarein-d6 (major)(>90%)
CAS:Controlled ProductFormula:C15D6H4O6Purity:>90%Color and Shape:Dark YellowMolecular weight:292.273Scutellarein
CAS:Applications Scutellarein is a flavonoid that can be found in Scutellaria lateriflora. Scutellarein is a hydrolysis product of Scutellarein (S201900), its glucuronide conjugated analogue.
References Qiu, F. et al.: Planta Med., 73, 363 (2007); Parajuli, P. et al.: Planta Med., 75, 41 (2009); Wang, Y. et al.: Xenobiotica, 41, 538 (2011);Formula:C15H10O6Purity:>90%Color and Shape:NeatMolecular weight:286.24Scutellarein
CAS:Scutellarein is a flavonoid compound, which is derived from plants such as Scutellaria baicalensis (commonly known as Chinese skullcap). This flavonoid exists naturally in certain herbs and plays a significant role in traditional medicine practices. It is extracted from the aerial parts of these plants through various processing techniques, focusing on its bioactive potential.
Formula:C15H10O6Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:286.24 g/mol










