
CAS 529-81-7
:Troger base
Description:
Troger's base, with the CAS number 529-81-7, is a bicyclic organic compound characterized by its unique structure, which features two fused imidazole rings. This compound is notable for its chiral nature, possessing two stereogenic centers, which allows for the existence of multiple stereoisomers. Troger's base is typically synthesized through the condensation of an amine with an aldehyde, followed by cyclization. It is recognized for its basicity and ability to form stable salts with acids. Troger's base has applications in organic synthesis, particularly in the development of chiral ligands and catalysts, due to its ability to facilitate asymmetric reactions. Additionally, it has been studied for its potential biological activities, including its interactions with various biological targets. The compound is generally stable under standard conditions but may undergo reactions typical of amines, such as alkylation or acylation. Overall, Troger's base is an important compound in both synthetic organic chemistry and medicinal chemistry research.
Formula:C17H18N2
InChI:InChI=1S/C17H18N2/c1-12-3-5-16-14(7-12)9-18-11-19(16)10-15-8-13(2)4-6-17(15)18/h3-8H,9-11H2,1-2H3
InChI key:InChIKey=SXPSZIHEWFTLEQ-UHFFFAOYSA-N
SMILES:CC=1C=C2C(N3CN(C2)C=4C(C3)=CC(C)=CC4)=CC1
Synonyms:- Troger's base
- 6H,12H-5,11-Methanodibenzo[b,f][1,5]diazocine, 2,8-dimethyl-
- 2,8-Dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine
- Troeger's base
- (±)-Troeger's base
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,8-Dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine
CAS:Formula:C17H18N2Purity:98%Molecular weight:250.3382Troger’S
CAS:Troger’s is a fluorescent probe that can be used to measure the hydrogen bond in amines. It is synthesized by reacting trifluoroacetic acid with coumarin derivatives and an amine. Troger’s has been shown to have high fluorescence intensity and a wide spectral range (250-400 nm). The fluorescence intensity of Troger’s was found to be proportional to the concentration of amines. This probe has also been used as a skeleton for polymeric matrices, which are activated by nitrogen atoms. Activation energies for these polymer matrices have been found to be between 1-3 kcal/mol.
Formula:C17H18N2Purity:Min. 95%Molecular weight:250.34 g/mol

