CAS 52905-00-7
:N-(2-aminophenyl)-3-methylbutanamide
Description:
N-(2-aminophenyl)-3-methylbutanamide, also known by its CAS number 52905-00-7, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a 3-methylbutanamide backbone, indicating the presence of a branched alkyl chain, and a 2-aminophenyl group, which contributes to its aromatic properties. The presence of the amino group (-NH2) on the phenyl ring enhances its potential for hydrogen bonding and increases its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic ring and the alkyl chain. Overall, N-(2-aminophenyl)-3-methylbutanamide is a compound of interest due to its unique structural features and potential applications in various fields.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-8(2)7-11(14)13-10-6-4-3-5-9(10)12/h3-6,8H,7,12H2,1-2H3,(H,13,14)
SMILES:CC(C)CC(=Nc1ccccc1N)O
Synonyms:- butanamide, N-(2-aminophenyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.