CAS 5291-77-0
:1-Benzyl-2-pyrrolidinone
Description:
1-Benzyl-2-pyrrolidinone, with the CAS number 5291-77-0, is an organic compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its polar nature due to the presence of the carbonyl group in the lactam, which contributes to its solubility in polar solvents like water, alcohols, and some organic solvents. The benzyl group enhances its hydrophobic characteristics, making it less soluble in non-polar solvents. 1-Benzyl-2-pyrrolidinone is often utilized in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the presence of both the carbonyl and the nitrogen atom in the pyrrolidinone ring, allowing for various chemical transformations. Additionally, it may exhibit biological activity, although specific applications and effects can vary widely depending on the context of use. Safety data should be consulted for handling and exposure guidelines.
Formula:C11H13NO
InChI:InChI=1S/C11H13NO/c13-11-7-4-8-12(11)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2
InChI key:InChIKey=LVUQCTGSDJLWCE-UHFFFAOYSA-N
SMILES:C(N1C(=O)CCC1)C2=CC=CC=C2
Synonyms:- 1-(Phenylmethyl)-2-pyrrolidinone
- 1-Benzyl-2-Pyrrolidone
- 1-Benzyl-2-oxopyrrolidine
- 1-Benzyl-4-Pyrrolidinone
- 1-Benzyl-Pyrrolidin-2-One
- 1-Benzylazacyclopentan-2-one
- 2-Pyrrolidinone, 1-(phenylmethyl)-
- 2-Pyrrolidinone, 1-benzyl-
- N-Benzyl Pyrrolidone
- N-Benzyl pyrrolidinone
- N-Benzyl-2-pyrrolidone
- N-Benzylbutyrolactam
- N-Benzylpyrrolidin-2-one
- N-Benzylpyrrolidone
- NSC 30184
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzylpyrrolidin-2-one
CAS:Formula:C11H13NOPurity:98%Color and Shape:LiquidMolecular weight:175.22701-Benzyl-2-pyrrolidinone
CAS:1-Benzyl-2-pyrrolidinonePurity:98%Color and Shape:LiquidMolecular weight:175.23g/mol1-Benzyl-2-pyrrolidinone
CAS:1-Benzyl-2-pyrrolidinone is a solvent that belongs to the group of organic solvents. It has a low boiling point and is used in the synthesis of amines, lactams, and other organic compounds. 1-Benzyl-2-pyrrolidinone has been shown to be a good nucleophile due to its high reactivity and stability. This compound can be used for sulfate fractionation by reacting with sodium sulfate anion to form an ionic complex. The resulting ionic liquid can then be separated from the organic solvent by adding hydrochloric acid as an acceptor.
Formula:C11H13NOPurity:Min. 97.5 Area-%Color and Shape:Clear LiquidMolecular weight:175.23 g/mol1-Benzyl-2-pyrrolidinone
CAS:Formula:C11H13NOPurity:97.0%Color and Shape:LiquidMolecular weight:175.231



