CAS 5292-23-9
:3-(4-chlorophenyl)butanoic acid
Description:
3-(4-Chlorophenyl)butanoic acid, with the CAS number 5292-23-9, is an organic compound characterized by its butanoic acid backbone substituted with a 4-chlorophenyl group at the third carbon position. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic ring. The presence of the chlorophenyl group imparts unique chemical properties, including potential biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group (-COOH) allows for acidic behavior, enabling it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H11ClO2
InChI:InChI=1/C10H11ClO2/c1-7(6-10(12)13)8-2-4-9(11)5-3-8/h2-5,7H,6H2,1H3,(H,12,13)
SMILES:CC(CC(=O)O)c1ccc(cc1)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery