CAS 5292-54-6
:diethyl (diphenylmethyl)propanedioate
Description:
Diethyl (diphenylmethyl)propanedioate, with the CAS number 5292-54-6, is an organic compound characterized by its ester functional groups and a complex structure that includes both ethyl and diphenylmethyl moieties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the diphenylmethyl group contributes to its stability and potential applications in organic synthesis, particularly in the formation of various derivatives. Diethyl (diphenylmethyl)propanedioate can be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its reactivity and ability to undergo various chemical transformations. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled, necessitating appropriate safety measures during handling and experimentation.
Formula:C20H22O4
InChI:InChI=1/C20H22O4/c1-3-23-19(21)18(20(22)24-4-2)17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3
SMILES:CCOC(=O)C(C(c1ccccc1)c1ccccc1)C(=O)OCC
Synonyms:- Diethyl (diphenylmethyl)malonate
- Propanedioic Acid, 2-(Diphenylmethyl)-, Diethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
