CAS 52932-62-4
:(1R,2S,3S,4R,5S,6R)-3-({[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}amino)-6-(carbamoyloxy)-2,4,5-trihydroxycyclohexyl 4-O-(2-deoxy-2-{[N~5~-(diaminomethylidene)-L-ornithyl]amino}-alpha-D-glucopyranosyl)-beta-D-mannopyranoside
Description:
The chemical substance with the name "(1R,2S,3S,4R,5S,6R)-3-({[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}amino)-6-(carbamoyloxy)-2,4,5-trihydroxycyclohexyl 4-O-(2-deoxy-2-{[N~5~-(diaminomethylidene)-L-ornithyl]amino}-alpha-D-glucopyranosyl)-beta-D-mannopyranoside" and CAS number "52932-62-4" is a complex organic molecule characterized by multiple functional groups and stereocenters. It features a cyclohexyl ring with hydroxyl groups, indicating potential for hydrogen bonding and solubility in polar solvents. The presence of amino and carbamoyloxy groups suggests biological activity, possibly as a peptide or glycoside, which may interact with biological receptors or enzymes. The molecule also contains sugar moieties, indicating it may play a role in carbohydrate metabolism or cellular signaling. Its stereochemistry, denoted by the specific R and S configurations, implies that it may exhibit chirality, influencing its biological interactions and pharmacological properties. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry or biochemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C30H53N9O17
InChI:InChI=1/C30H53N9O17/c31-8(2-1-5-36-29(33)34)25(49)39-14-17(44)15(42)10(6-40)52-27(14)54-22-11(7-41)53-28(21(48)20(22)47)55-23-18(45)13(16(43)19(46)24(23)56-30(35)51)38-26(50)9-3-4-12(32)37-9/h8-11,13-24,27-28,40-48H,1-7,31H2,(H2,32,37)(H2,35,51)(H,38,50)(H,39,49)(H4,33,34,36)/t8-,9-,10+,11+,13-,14+,15+,16+,17+,18-,19-,20+,21-,22+,23+,24+,27+,28-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LL-BM123α
CAS:LL-BM123α is a basic antibiotic isolated from Nocardia species and exhibits moderate activity against Gram-negative bacteria.Formula:C30H53N9O17Molecular weight:811.79

