CymitQuimica logo

CAS 52934-85-7

:

Nanaomycin B

Description:
Nanaomycin B is a naturally occurring antibiotic compound that belongs to the class of polyketides. It is produced by certain strains of the bacterium *Streptomyces*, which are known for their ability to synthesize a wide variety of bioactive secondary metabolites. Nanaomycin B exhibits notable antibacterial and antitumor properties, making it of interest in pharmaceutical research. The compound has a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. Its mechanism of action typically involves interference with nucleic acid synthesis, which is crucial for the growth and proliferation of bacteria and cancer cells. Additionally, Nanaomycin B has been studied for its potential in treating various types of cancer, although further research is needed to fully understand its efficacy and safety in clinical applications. As with many natural products, the extraction and purification processes can be challenging, and ongoing studies aim to optimize these methods for better yield and activity.
Formula:C16H16O7
InChI:InChI=1/C16H16O7/c1-7-16(22)10(5-8(23-7)6-12(18)19)14(20)9-3-2-4-11(17)13(9)15(16)21/h2-4,7-8,10,17,22H,5-6H2,1H3,(H,18,19)/t7?,8-,10?,16+/m1/s1
Synonyms:
  • Nanaomycin B
  • Antibiotic OS-3966B
  • (1S)-3,4,4aα,5,10,10a-Hexahydro-9,10aβ-dihydroxy-1-methyl-5,10-dioxo-1H-naphtho[2,3-c]pyran-3β-acetic acid
  • 1H-Naphtho[2,3-c]pyran-3-acetic acid, 3,4,4a,5,10,10a-hexahydro-9,10a-dihydroxy-1-methyl-5,10-dioxo-, (1S,3R,4aR,10aR)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Nanaomycin B

    CAS:
    <p>Nanaomycin B is an antibiotic with activity against Gram-positive bacteria, mycobacteria, mycoplasma, and fungi.</p>
    Formula:C16H16O7
    Color and Shape:Solid
    Molecular weight:320.294