CAS 52936-64-8
:Caulophyllogenin
Description:
Caulophyllogenin is a chemical compound classified as a triterpenoid saponin, primarily derived from the roots of the plant Caulophyllum thalictroides, commonly known as blue cohosh. It is characterized by its complex structure, which includes multiple rings and functional groups that contribute to its biological activity. The compound is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, and has been studied for its role in traditional medicine, particularly in relation to women's health. Caulophyllogenin exhibits low solubility in water but is more soluble in organic solvents, which is typical for many triterpenoids. Its molecular structure allows it to interact with various biological targets, making it of interest in medicinal chemistry. Additionally, safety and toxicity profiles are essential considerations in its application, as with many natural compounds. Overall, caulophyllogenin represents a significant area of research in phytochemistry and pharmacognosy, highlighting the importance of plant-derived substances in therapeutic development.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-25(2)13-14-30(24(34)35)19(15-25)18-7-8-21-26(3)11-10-22(32)27(4,17-31)20(26)9-12-28(21,5)29(18,6)16-23(30)33/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22-,23+,26-,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=FABOBEOYNMHSHB-UAWZMHPWSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(C[C@H]1O)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@@H](O)CC5)[H])[H])(CC(C)(C)CC2)[H]
Synonyms:- (3beta,16alpha)-3,16,23-Trihydroxyolean-12-en-28-oic acid
- (3beta,16alpha)-3,16,23-Trihydroxyolean-12-en-28-s?ure
- (4aR,5R,6aS,6bR,8aR,9R,10S,12aR,12bR,14bS)-5,10-Dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydro-4a(2H)-picencarbons?ure
- (4aR,5R,6aS,6bR,8aR,9R,10S,12aR,12bR,14bS)-5,10-Dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydro-4a(2H)-picenecarboxylic acid
- Acide (3bêta,16alpha)-3,16,23-trihydroxyolean-12-én-28-o?que
- Acide (4aR,5R,6aS,6bR,8aR,9R,10S,12aR,12bR,14bS)-5,10-dihydroxy-9-(hydroxyméthyl)-2,2,6a,6b,9,12a-hexaméthyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadécahydro-4a(2H)-picènecarboxylique
- Caulophyllogenin
- Collinsogenin
- Olean-12-En-28-Oic Acid, 3,16,23-Trihydroxy-, (3Beta,16Alpha)-
- Olean-12-en-28-oic acid, 3,16,23-trihydroxy-, (3β,4α,16α)-
- (3β,4α,16α)-3,16,23-Trihydroxyolean-12-en-28-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Caulophyllogenin
CAS:Caulophyllogenin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H48O5Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:488.71Caulophyllogenin
CAS:Caulophyllogenin, from Kalopanax pictus, is a PPARγ agonist with anti-inflammatory properties, targeting diabetes and obesity.Formula:C30H48O5Purity:99.69%Color and Shape:SolidMolecular weight:488.7Caulophyllogenin
CAS:Controlled Product<p>Caulophyllogenin is a natural product, which is a triterpenoid saponin derived from plants of the genus Caulophyllum, such as Caulophyllum thalictroides (blue cohosh). The compound acts by inducing apoptosis and inhibiting cell proliferation. This mode of action is particularly significant in the context of cancer research, where it is utilized to study its potential therapeutic effects and underlying mechanisms.</p>Formula:C30H48O5Purity:Min. 98.5 Area-%Color and Shape:PowderMolecular weight:488.7 g/mol
