CAS 52938-99-5: 5-(4-Methoxyphenyl)-2-furancarboxylic acid

Description:5-(4-Methoxyphenyl)-2-furancarboxylic acid, with the CAS number 52938-99-5, is an organic compound characterized by its unique structure that includes a furan ring and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of carboxylic acid functional groups. The methoxy group can influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the furan ring contributes to its stability and may participate in various chemical reactions, including oxidation and polymerization. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and material science. Its synthesis often involves the functionalization of furan derivatives, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, 5-(4-Methoxyphenyl)-2-furancarboxylic acid is a versatile compound with potential applications in various fields.

Formula:C₁₂H₁₀O₄

InChI:InChI=1S/C12H10O4/c1-15-9-4-2-8(3-5-9)10-6-7-11(16-10)12(13)14/h2-7H,1H3,(H,13,14)

InChI key:InChIKey=YEBLYHKPTQJGEC-UHFFFAOYSA-N

SMILES:O=C(O)C=1OC(=CC1)C=2C=CC(OC)=CC2

Synonyms:
2-Furancarboxylic acid, 5-(4-methoxyphenyl)-
5-(4-Methoxyphenyl)-2-furancarboxylic acid
5-(4-Methoxyphenyl)-2-furoic acid
5-(p-Methoxyphenyl)-2-furancarboxylic acid
5-(4-Methoxyphenyl)furan-2-carboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-(4-methoxyphenyl)-2-furoic acid REF: IN-DA00D8EOCAS: 52938-99-5	- - -	To inquire	Tue 12 Aug 25
5-(4-Methoxyphenyl)-2-furoic acid REF: 54-OR7480CAS: 52938-99-5	- - -	75.00 €~201.00 €	Wed 13 Aug 25
5-(4-Methoxy-phenyl)-furan-2-carboxylic acid REF: 10-F027546CAS: 52938-99-5	95.0%	To inquire	Fri 22 Aug 25
5-(4-Methoxyphenyl)-2-furoic acid REF: 3D-FM128914CAS: 52938-99-5	Min. 95%	- - -	Discontinued product