CAS 52940-48-4

6-(morpholin-4-yl)-9-pentofuranosyl-9H-purine

Description:

6-(Morpholin-4-yl)-9-pentofuranosyl-9H-purine, with the CAS number 52940-48-4, is a purine derivative characterized by the presence of a morpholine ring and a pentofuranosyl sugar moiety. This compound exhibits properties typical of nucleosides, including potential biological activity related to nucleic acid metabolism. The morpholine group may enhance solubility and bioavailability, while the purine base is crucial for interactions with nucleic acid structures. The compound's structure suggests it could participate in various biochemical pathways, possibly acting as a substrate or inhibitor in enzymatic reactions. Its unique configuration may also influence its pharmacological properties, making it a candidate for further research in medicinal chemistry, particularly in the development of antiviral or anticancer agents. As with many purine derivatives, it may exhibit interactions with specific receptors or enzymes, warranting investigation into its therapeutic potential and mechanism of action.

Formula: C₁₄H₁₉N₅O₅

InChI: InChI=1/C14H19N5O5/c20-5-8-10(21)11(22)14(24-8)19-7-17-9-12(15-6-16-13(9)19)18-1-3-23-4-2-18/h6-8,10-11,14,20-22H,1-5H2

SMILES: C1COCCN1c1c2c(ncn1)n(cn2)C1C(C(C(CO)O1)O)O

6-(4-Morpholino)-9-(β-D-ribofuranosyl)-9H-purine

CAS: 52940-48-4

6-(4-Morpholino)-9-(beta-D-ribofuranosyl)-9H-purine is a Nucleoside Derivative - 6-Modified purine nucleoside.

Formula: C₁₄H₁₉N₅O₅

Color and Shape: Solid

Molecular weight: 337.33

Ref: TM-TNU0343

6-(4-Morpholino)-9-(β-D-ribofuranosyl)-9H-purine

CAS: 52940-48-4

6-(4-Morpholino)-9-(β-D-ribofuranosyl)-9H-purine is a modified monophosphate analog of adenosine. It is an antiviral agent that inhibits the synthesis of nucleic acids in virus-infected cells, preventing viral replication and spread. 6-(4-Morpholino)-9-(β-D-ribofuranosyl)-9H-purine is also used as a radiosensitizer to treat cancer. This drug is synthesized by high purity, high quality and reliable suppliers.

Formula: C₁₄H₁₉N₅O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 337.33 g/mol

Ref: 3D-NM163017