CAS 52943-20-1

2-chloro-N-methylpyridine-3-carboxamide

Description:

2-Chloro-N-methylpyridine-3-carboxamide, with the CAS number 52943-20-1, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the second position and a carboxamide functional group at the third position of the pyridine ring, along with a methyl group attached to the nitrogen atom of the amide. The presence of the chlorine atom introduces unique reactivity and polarity, while the carboxamide group contributes to its potential as a hydrogen bond donor and acceptor. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its functional groups. Its chemical properties make it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₇H₇ClN₂O

InChI: InChI=1/C7H7ClN2O/c1-9-7(11)5-3-2-4-10-6(5)8/h2-4H,1H3,(H,9,11)

SMILES: CN=C(c1cccnc1Cl)O

Synonyms:

• 2-Chloro-N-methylnicotinamide
• 3-pyridinecarboxamide, 2-chloro-N-methyl-

2-Chloro-N-methylnicotinamide

CAS: 52943-20-1

Formula: C₇H₇ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 170.5963

Ref: IN-DA00DIT8

2-Chloro-N-methylnicotinamide

CAS: 52943-20-1

2-Chloro-N-methylnicotinamide

Purity: 99%

Molecular weight: 170.60g/mol

Ref: 54-OR927612

2-chloro-N-methylnicotinamide

CAS: 52943-20-1

Formula: C₇H₇ClN₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 170.6

Ref: 10-F316086