CAS 529512-81-0
:2-Fluoro-6-methoxybenzamide
Description:
2-Fluoro-6-methoxybenzamide is an organic compound characterized by the presence of a fluorine atom and a methoxy group attached to a benzamide structure. The fluorine atom is located at the second position of the benzene ring, while the methoxy group (-OCH3) is situated at the sixth position. This compound exhibits properties typical of aromatic amides, including potential solubility in organic solvents and moderate polarity due to the presence of both the amide and methoxy functional groups. The fluorine substitution can influence the compound's reactivity, stability, and biological activity, often enhancing lipophilicity and altering hydrogen bonding capabilities. 2-Fluoro-6-methoxybenzamide may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H8FNO2
InChI:InChI=1/C8H8FNO2/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H2,10,11)
SMILES:COc1cccc(c1C(=N)O)F
Synonyms:- Benzamide, 2-fluoro-6-methoxy-
- 2-Fluoro-6-methoxy-benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-6-methoxybenzamide, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H8FNO2Purity:98%Color and Shape:Powder, WhiteMolecular weight:169.162-Fluoro-6-methoxybenzamide
CAS:Formula:C8H8FNO2Purity:98%Color and Shape:SolidMolecular weight:169.15302-Fluoro-6-methoxybenzamide
CAS:Formula:C8H8FNO2Purity:98.0%Color and Shape:SolidMolecular weight:169.155



