CAS 5296-34-4

(2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane

Description:

The chemical substance known as (2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane, with the CAS number 5296-34-4, is an epoxide compound characterized by its three-membered cyclic ether structure, which includes an oxygen atom and two carbon atoms. This compound features a chiral center at the second carbon, contributing to its stereochemistry. The presence of the 2,6-dimethylphenoxy group enhances its hydrophobic characteristics, making it more soluble in organic solvents than in water. Epoxides are known for their reactivity, particularly in ring-opening reactions, which can be facilitated by nucleophiles. This compound may be utilized in various applications, including as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the substituents present. Safety data should be consulted for handling and storage, as epoxides can be hazardous due to their potential to cause skin and respiratory irritation.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-8-4-3-5-9(2)11(8)13-7-10-6-12-10/h3-5,10H,6-7H2,1-2H3/t10-/m1/s1

SMILES: Cc1cccc(C)c1OC[C@H]1CO1

2-[(2,6-Dimethylphenoxy)methyl]oxirane

CAS: 5296-34-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₂

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-FAA29634