CAS 52960-57-3
:2-methoxybenzenesulfonamide
Description:
2-Methoxybenzenesulfonamide, also known as o-methoxybenzenesulfonamide, is an organic compound characterized by the presence of a methoxy group (-OCH₃) and a sulfonamide group (-SO₂NH₂) attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the sulfonamide functional group, which can engage in hydrogen bonding. The methoxy group enhances the compound's solubility and can influence its reactivity and biological activity. 2-Methoxybenzenesulfonamide is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of various biologically active molecules. Its sulfonamide moiety is known for its antibacterial properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as moderate stability under standard conditions and the ability to participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the methoxy group.
Formula:C7H9NO3S
InChI:InChI=1/C7H9NO3S/c1-11-6-4-2-3-5-7(6)12(8,9)10/h2-5H,1H3,(H2,8,9,10)
SMILES:COc1ccccc1S(=O)(=O)N
Synonyms:- Benzenesulfonamide, 2-Methoxy-
- 2-Methoxybenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Methoxybenzenesulfonamide
CAS:Formula:C7H9NO3SPurity:95%Color and Shape:SolidMolecular weight:187.21632-Methoxybenzene sulphonamide
CAS:2-Methoxybenzene sulphonamide is an anti-cancer drug that belongs to the class of hydroxylated aromatic compounds. It has been shown to inhibit the growth of cancer cells in culture and in animals, and to prevent the formation of metastases. 2-Methoxybenzene sulphonamide is also a vasodilator drug used for the treatment of congestive heart failure. This drug binds to dopamine receptors in humans and may inhibit phosphatase activity. It has been shown to act as an antihypertensive by inhibiting angiotensin II mediated hypertrophy of cardiac tissue.Formula:C7H9NO3SPurity:Min. 95%Color and Shape:White PowderMolecular weight:187.22 g/mol


