CAS 52962-25-1
:2-Carboxy-4-methoxybenzeneacetic acid
Description:
2-Carboxy-4-methoxybenzeneacetic acid, also known as a derivative of benzoic acid, is characterized by its aromatic structure featuring both carboxylic acid and methoxy functional groups. This compound typically exhibits properties associated with both aromatic and aliphatic acids, including moderate solubility in polar solvents due to the presence of the carboxylic acid group. The methoxy group contributes to its overall hydrophobic character while also influencing its reactivity and potential interactions in biological systems. The presence of multiple functional groups allows for various chemical reactions, including esterification and amidation. This compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in organic synthesis and as a building block for more complex molecules. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications.
Formula:C10H10O5
InChI:InChI=1S/C10H10O5/c1-15-7-3-2-6(4-9(11)12)8(5-7)10(13)14/h2-3,5H,4H2,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=TUJHFMJYEXSKLS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C(O)=O)C=C(OC)C=C1
Synonyms:- 2-Carboxy-4-methoxybenzeneacetic acid
- 2-Carboxymethyl-5-methoxy-benzoic acid
- 4-Methoxyhomophthalic acid
- Benzeneacetic acid, 2-carboxy-4-methoxy-
- m-Anisic acid, 6-(carboxymethyl)-
- 2-Carboxymethyl-5-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Carboxymethyl)-5-methoxybenzoic Acid
CAS:Controlled ProductApplications 2-(carboxymethyl)-5-methoxybenzoic Acid (cas# 52962-25-1) is used in making heat-developable photographic film with improved storage stability.
References Sakai, M., et al.: Jpn. Kokai Tokkyo Koho. 88 pp. (2008)Formula:C10H10O5Color and Shape:NeatMolecular weight:210.1832-(carboxymethyl)-5-methoxybenzoic Acid
CAS:2-(carboxymethyl)-5-methoxybenzoic acid is a potent and selective agonist of the α receptor. It has been synthesized by reacting 2-bromo-4,6-dimethoxyphenol with methanol in the presence of hydrochloric acid. This compound has been shown to inhibit proliferation of cancer cells and induce apoptosis in vitro. It also inhibits growth factor signaling pathways, which may be due to its ability to block protein kinase C. 2-(Carboxymethyl)-5-methoxybenzoic acid has been shown to have anticancer activity in vivo and can be used as a potential therapy for cancer patients.Formula:C10H10O5Purity:Min. 95%Molecular weight:210.18 g/mol


