CAS 52977-95-4
:3-(4-chlorophenyl)-4-hydroxybutanoic acid
Description:
3-(4-Chlorophenyl)-4-hydroxybutanoic acid, with the CAS number 52977-95-4, is an organic compound characterized by its structure, which includes a butanoic acid backbone substituted with a hydroxyl group and a para-chlorophenyl group. This compound typically exhibits properties associated with both acidic and phenolic functionalities, making it a weak acid. It is likely to be soluble in polar solvents due to the presence of the hydroxyl group, while the chlorophenyl moiety may impart hydrophobic characteristics. The compound may participate in various chemical reactions, such as esterification or amidation, due to its carboxylic acid group. Additionally, the presence of the chlorine atom can influence its reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological systems. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C10H11ClO3
InChI:InChI=1/C10H11ClO3/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8,12H,5-6H2,(H,13,14)
SMILES:c1cc(ccc1C(CC(=O)O)CO)Cl
Synonyms:- Benzenepropanoic Acid, 4-Chloro-Beta-(Hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Baclofen Impurity 2 (β-(4-Chlorophenyl)-gama-Hydroxybutyric Acid)
CAS:Formula:C10H11ClO3Molecular weight:214.65

