CAS 52981-07-4

[4-(3-methylbenzoyl)phenyl] acetate

Description:

[4-(3-methylbenzoyl)phenyl] acetate, with the CAS number 52981-07-4, is an organic compound characterized by its aromatic structure and ester functional group. It features a phenyl ring substituted with a 3-methylbenzoyl group and an acetate moiety, which contributes to its chemical reactivity and potential applications. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the presence of multiple aromatic rings. The presence of the acetyl group suggests that it may participate in various chemical reactions, including hydrolysis and transesterification. Additionally, the compound may display interesting photophysical properties, making it of interest in fields such as materials science and organic synthesis. Its molecular structure allows for potential interactions in biological systems, although specific biological activity would require further investigation. Overall, [4-(3-methylbenzoyl)phenyl] acetate is a versatile compound with applications in organic chemistry and potentially in the development of functional materials.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-11-4-3-5-14(10-11)16(18)13-6-8-15(9-7-13)19-12(2)17/h3-10H,1-2H3

SMILES: Cc1cccc(c1)C(=O)c1ccc(cc1)OC(=O)C

4-Acetoxy-3′-methylbenzophenone

CAS: 52981-07-4

Formula: C₁₆H₁₄O₃

Purity: 90.0%

Molecular weight: 254.285

Ref: 10-F201837