CAS 52988-34-8

4'-Methoxybiphenyl-4-carbaldehyde

Description:

4'-Methoxybiphenyl-4-carbaldehyde, with the CAS number 52988-34-8, is an organic compound characterized by its biphenyl structure substituted with a methoxy group and an aldehyde functional group. This compound typically appears as a pale yellow to light brown solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity and interactions in various chemical reactions. The aldehyde functional group is reactive, making it a potential candidate for further chemical transformations, such as condensation reactions or as an intermediate in organic synthesis. Additionally, this compound may exhibit interesting biological activities, which could be explored in medicinal chemistry. Its structural features suggest potential applications in the development of dyes, pharmaceuticals, or as a building block in organic synthesis. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity and reactivity.

Formula: C₁₄H₁₂O₂

InChI: InChI=1/C14H12O2/c1-16-14-8-6-13(7-9-14)12-4-2-11(10-15)3-5-12/h2-10H,1H3

SMILES: COc1ccc(cc1)c1ccc(cc1)C=O

Synonyms:

• 4'-Methoxy[1,1'-biphenyl]-4-carbaldehyde

4-(4-Methoxyphenyl)benzaldehyde

CAS: 52988-34-8

Formula: C₁₄H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.248

Ref: 10-F014277

4'-Methoxybiphenyl-4-carbaldehyde

CAS: 52988-34-8

Formula: C₁₄H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2439

Ref: IN-DA00DE3G

4'-Methoxy-[1,1'-biphenyl]-4-carboxaldehyde

CAS: 52988-34-8

4'-Methoxy-[1,1'-biphenyl]-4-carboxaldehyde

Purity: 99%

Color and Shape: Off-White Solid

Molecular weight: 212.24g/mol

Ref: 54-OR7460