CAS 5299-52-5
:Oleoylmorpholine
Description:
Oleoylmorpholine, with the CAS number 5299-52-5, is an organic compound characterized by its morpholine structure substituted with an oleoyl group. This substance typically appears as a viscous liquid or solid, depending on the temperature. It is known for its surfactant properties, making it useful in various applications, including as an emulsifier and dispersant in formulations. Oleoylmorpholine exhibits moderate solubility in organic solvents and limited solubility in water, which is common for fatty acid derivatives. The compound is generally stable under normal conditions but may undergo hydrolysis in the presence of strong acids or bases. Its molecular structure contributes to its ability to interact with both hydrophilic and hydrophobic substances, enhancing its effectiveness in formulations. Safety data indicates that, like many morpholine derivatives, it should be handled with care due to potential irritant effects on skin and eyes. Overall, oleoylmorpholine is valued in industrial and research settings for its functional properties and versatility.
Formula:C22H41NO2
InChI:InChI=1S/C22H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(24)23-18-20-25-21-19-23/h9-10H,2-8,11-21H2,1H3/b10-9-
InChI key:InChIKey=RZLQCNYCMRDLBA-KTKRTIGZSA-N
SMILES:C(CCCCCCC/C=C\CCCCCCCC)(=O)N1CCOCC1
Synonyms:- Oleoylmorpholine
- Morpholine, 4-[(9Z)-1-oxo-9-octadecenyl]-
- Oleic acid morpholide
- Morpholine, 4-(1-oxo-9-octadecenyl)-, (Z)-
- Morpholine, 4-oleoyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
