CAS 530-22-3
:Egonol
Description:
Egonol, with the CAS number 530-22-3, is a chemical compound known for its role as a natural product and potential therapeutic agent. It is classified as a phenolic compound, specifically a type of monoterpenoid, which contributes to its aromatic properties. Egonol is primarily derived from various plant sources, particularly in the essential oils of certain herbs. Its structure features a hydroxyl group, which enhances its reactivity and solubility in polar solvents. Egonol exhibits antioxidant properties, making it of interest in food preservation and cosmetic formulations. Additionally, it has been studied for its potential anti-inflammatory and antimicrobial effects, suggesting applications in pharmaceuticals and natural remedies. The compound is typically characterized by its pleasant aroma and is often used in perfumery and flavoring. Safety data indicates that, while generally recognized as safe in low concentrations, further research is necessary to fully understand its biological effects and potential toxicity at higher doses.
Formula:C19H18O5
InChI:InChI=1S/C19H18O5/c1-21-18-8-12(3-2-6-20)7-14-10-16(24-19(14)18)13-4-5-15-17(9-13)23-11-22-15/h4-5,7-10,20H,2-3,6,11H2,1H3
InChI key:InChIKey=VOLZBKQSLGCZGC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=C(O2)C=3C=C4C(=CC3)OCO4)=CC(CCCO)=C1
Synonyms:- 2-(1,3-Benzodioxol-5-yl)-7-methoxy-5-benzofuranpropanol
- 3-(2-Benzo[1,3]dioxol-5-yl-7-methoxy-benzofuran-5-yl)-propan-1-ol
- 5-Benzofuranpropanol, 2-(1,3-benzodioxol-5-yl)-7-methoxy-
- 5-Benzofuranpropanol, 7-methoxy-2-[3,4-(methylenedioxy)phenyl]-
- 530-22-3
- Egonol
- 3-[2-(1,3-Benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
