CAS 53008-63-2
:Methyl 2,3,4,6-tetra-O-benzyl-a-D-galactopyranoside
Description:
Methyl 2,3,4,6-tetra-O-benzyl-α-D-galactopyranoside is a glycoside derived from galactose, characterized by the presence of multiple benzyl groups attached to the hydroxyl positions of the sugar moiety. This compound features a methyl group at the anomeric position, which influences its reactivity and solubility. It is typically a white to off-white crystalline solid, soluble in organic solvents such as methanol and dichloromethane, but less soluble in water due to its hydrophobic benzyl substituents. The presence of the benzyl groups enhances its stability and can affect its biological activity, making it useful in various synthetic applications, particularly in carbohydrate chemistry and glycosylation reactions. Additionally, it may serve as a protective group in the synthesis of more complex carbohydrates or as a building block in the development of glycosylated compounds for pharmaceutical research. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C35H38O6
InChI:InChI=1S/C35H38O6/c1-36-35-34(40-25-30-20-12-5-13-21-30)33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(41-35)26-37-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2,1H3/t31-,32+,33+,34-,35+/m1/s1
InChI key:InChIKey=IXEBJCKOMVGYKP-NVCPMKERSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@@H](OCC3=CC=CC=C3)[C@@H](COCC4=CC=CC=C4)O[C@H](OC)[C@@H]2OCC5=CC=CC=C5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2,3,4,6-tetra-O-benzyl-α-D-galactopyranoside
CAS:Methyl 2,3,4,6-tetra-O-benzyl-α-D-galactopyranoside (MBGT) is a pharmaceutical that belongs to the class of aziridines. It has shown high light emission properties at temperatures between 25 and 50 °C. MBGT has been used as a shift reagent for the analysis of carbohydrates and glycols. The spectral shift exhibited by MBGT is due to the resonance stabilization of the molecule's excited state. This effect is increased by hydrogen peroxide, which acts as an oxidant and stabilizes the excited state via electron transfer. A bathochromic shift was observed in aqueous solutions at pH 4.5 when methyl 2,3,4,6-tetra-O-benzyl-α-D-galactopyranoside was combined with potassium hydroxide or sodium hydroxide as a base.Formula:C35H38O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:554.67 g/molMethyl 2,3,4,6-Tetra-O-benzyl-alpha-D-galactopyranoside
CAS:Controlled ProductFormula:C35H38O6Color and Shape:NeatMolecular weight:554.67


