CAS 530081-57-3

1-[(4-bromophenyl)sulfonyl]azetidine

Description:

1-[(4-bromophenyl)sulfonyl]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a sulfonyl group (-SO2-) attached to the azetidine, with a 4-bromophenyl substituent, indicating the presence of a bromine atom on a phenyl ring that is further connected to the sulfonyl group. This structure contributes to its potential reactivity and biological activity. The presence of the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. The sulfonyl group is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. As a result, 1-[(4-bromophenyl)sulfonyl]azetidine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies and characterization in various chemical contexts.

Formula: C₉H₁₀BrNO₂S

InChI: InChI=1/C9H10BrNO2S/c10-8-2-4-9(5-3-8)14(12,13)11-6-1-7-11/h2-5H,1,6-7H2

SMILES: C1CN(C1)S(=O)(=O)c1ccc(cc1)Br

1-(4-Bromophenylsulfonyl)azetidine

CAS: 530081-57-3

Formula: C₉H₁₀BrNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 276.1502

Ref: IN-DA00DABX

1-[(4-Bromophenyl)sulphonyl]azetidine

CAS: 530081-57-3

1-[(4-Bromophenyl)sulphonyl]azetidine

Purity: 98%

Color and Shape: Solid

Molecular weight: 276.15g/mol

Ref: 54-OR5812

1-((4-Bromophenyl)sulfonyl)azetidine

CAS: 530081-57-3

Formula: C₉H₁₀BrNO₂S

Purity: ≥95%

Molecular weight: 276.15

Ref: 10-F212662