CAS 53011-73-7
:2,4-Pentanediol, 1-(3-furanyl)-
Description:
2,4-Pentanediol, 1-(3-furanyl)- is an organic compound characterized by its structure, which includes a pentanediol backbone with a furan ring substituent. This compound features two hydroxyl (-OH) groups located at the 2 and 4 positions of the pentane chain, contributing to its classification as a diol. The presence of the furan ring, a five-membered aromatic heterocycle, imparts unique chemical properties, including potential reactivity in electrophilic substitution and polymerization reactions. The compound is likely to be a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the hydroxyl groups, while also being soluble in organic solvents. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit interesting biological activities, although specific data on its toxicity and environmental impact would require further investigation. Overall, 2,4-Pentanediol, 1-(3-furanyl)- represents a versatile compound with potential utility in various chemical applications.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c1-7(10)4-9(11)5-8-2-3-12-6-8/h2-3,6-7,9-11H,4-5H2,1H3
InChI key:InChIKey=VTUSNBRLKKKEAC-UHFFFAOYSA-N
SMILES:C(C(CC(C)O)O)C=1C=COC1
Synonyms:- 1,4-Ipomeadiol
- 1-(Furan-3-yl)pentane-2,4-diol
- 2,4-Pentanediol, 1-(3-furanyl)-
- 2,4-Pentanediol, 1-(3-furanyl)- (9CI)
- 1-(3-Furyl)pentane-2,4-diol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
