CymitQuimica logo

CAS 530115-96-9

:

4-Cyano-4-methylpiperidine-1-carboxylic acid tert-butyl ester

Description:
4-Cyano-4-methylpiperidine-1-carboxylic acid tert-butyl ester is a chemical compound characterized by its piperidine ring structure, which includes a cyano group and a tert-butyl ester functional group. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the carboxylic acid moiety, although it is in the form of an ester. The cyano group contributes to its polarity and potential reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The tert-butyl ester enhances its solubility in organic solvents, facilitating its use in reactions and formulations. Additionally, the compound may exhibit moderate stability under standard conditions but could be sensitive to hydrolysis, especially in the presence of moisture or acidic/basic conditions. Its unique structure allows for potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity and reactivity.
Formula:C12H20N2O2
InChI:InChI=1S/C12H20N2O2/c1-11(2,3)16-10(15)14-7-5-12(4,9-13)6-8-14/h5-8H2,1-4H3
InChI key:VREJUXWEWOVHHU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(C)(CC1)C#N
Synonyms:
  • tert-Butyl 4-cyano-4-methylpiperidine-1-carboxylate
  • 4-Cyano-4-methyl-piperidine-1-carboxylic acid tert-butyl ester
  • 1-Boc-4-cyano-4-methyl-piperidine
  • 1-Piperidinecarboxylic acid, 4-cyano-4-methyl-, 1,1-dimethylethyl ester
  • 2-Methyl-2-propanyl 4-cyano-4-methyl-1-piperidinecarboxylate
Found 5 products.