CAS 53012-82-1
:2,6-Dichloro-3-(trifluoromethyl)benzoyl chloride
Description:
2,6-Dichloro-3-(trifluoromethyl)benzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl chloride functional group. This compound features two chlorine atoms and a trifluoromethyl group attached to the benzene ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the electron-withdrawing trifluoromethyl group enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. As a reactive acyl chloride, it can readily undergo nucleophilic acyl substitution reactions, making it a valuable intermediate in organic synthesis. However, it is important to handle this compound with care due to its potential hazards, including corrosiveness and toxicity. Proper safety measures, including the use of personal protective equipment and working in a well-ventilated area, are essential when working with this substance.
Formula:C8H2Cl3F3O
InChI:InChI=1S/C8H2Cl3F3O/c9-4-2-1-3(8(12,13)14)6(10)5(4)7(11)15/h1-2H
InChI key:InChIKey=GDYRVUKFWOCVKN-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=O)C(Cl)=CC=C1C(F)(F)F
Synonyms:- 2,6-Dichloro-3-(trifluoromethyl)benzoyl chloride
- 2,6-Dichloro-α,α,α-trifluoro-m-toluoyl chloride
- Benzoyl chloride, 2,6-dichloro-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,6-Dichloro-3-(trifluoromethyl)benzoyl chloride
CAS:2,6-Dichloro-3-(trifluoromethyl)benzoyl chlorideFormula:C8H2Cl3F3OPurity:techColor and Shape: clear. almost colourless liquidMolecular weight:277.46g/mol

