CAS 53020-08-9
:3-Furancarboxylic acid, 2-(bromomethyl)-, methyl ester
Description:
3-Furancarboxylic acid, 2-(bromomethyl)-, methyl ester, with the CAS number 53020-08-9, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group and a bromomethyl substituent, contributing to its reactivity and potential applications in organic synthesis. The methyl ester group indicates that the carboxylic acid is esterified with methanol, enhancing its solubility in organic solvents and making it more amenable to various chemical reactions. The presence of the bromomethyl group suggests that it can participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the furan moiety is known for its biological activity and can be involved in various chemical transformations, including cycloadditions and electrophilic substitutions. Overall, this compound's unique structure and functional groups make it of interest in both synthetic organic chemistry and potential pharmaceutical applications.
Formula:C7H7BrO3
InChI:InChI=1S/C7H7BrO3/c1-10-7(9)5-2-3-11-6(5)4-8/h2-3H,4H2,1H3
InChI key:InChIKey=SOPVGIIHUGGHGO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CBr)OC=C1
Synonyms:- 2-Bromomethyl-furan-3-carboxylic acid methyl ester
- 3-Furancarboxylic acid, 2-(bromomethyl)-, methyl ester
- Methyl 2-(Bromomethyl)Furan-3-Carboxylate
- Methyl 2-bromomethyl-3-furancarboxylate
- Methyl 2-(bromomethyl)-3-furoate
- Methyl 2-(bromomethyl)-3-furoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-(bromomethyl)-3-furoate
CAS:Formula:C7H7BrO3Purity:98%Color and Shape:SolidMolecular weight:219.0327Methyl 2-(bromomethyl)-3-furoate
CAS:<p>Methyl 2-(bromomethyl)-3-furoate</p>Purity:techColor and Shape:SolidMolecular weight:219.03g/molMethyl 2-(bromomethyl)-3-furoate
CAS:<p>Methyl 2-(bromomethyl)-3-furoate is a muscarinic acetylcholine receptor agonist. It has been shown to bind to the M1 and M3 subtypes of the muscarinic acetylcholine receptors, but is not active against the M2 subtype. This drug has been shown to be an allosteric modulator of the acetylcholine receptors and will decrease the rate at which they are desensitized after binding to acetylcholine. Methyl 2-(bromomethyl)-3-furoate binds to a different site on the receptor than other agonists, such as carbachol and bethanechol, and offers advantages in terms of selectivity and optimization for both chemotypes and profiles.</p>Formula:C7H7BrO3Purity:Min. 95%Molecular weight:219.03 g/mol



