CAS 5304-71-2
:1-benzyl-2'-(4-methoxyphenyl)-9'-methyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazine]
Description:
1-Benzyl-2'-(4-methoxyphenyl)-9'-methyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazine] is a complex organic compound characterized by its unique structural features, which include a spirocyclic framework and multiple aromatic rings. The presence of a benzyl group and a methoxyphenyl substituent contributes to its potential for various interactions, making it of interest in medicinal chemistry. The compound exhibits a dihydrospiro structure, indicating it may possess interesting stereochemical properties. Its molecular architecture suggests potential biological activity, possibly as a pharmacophore in drug development. The CAS number 5304-71-2 identifies this substance in chemical databases, facilitating its study and application in research. As with many organic compounds, its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. Understanding its characteristics can provide insights into its potential applications in pharmaceuticals or materials science. Further studies would be necessary to elucidate its specific properties and biological activities.
Formula:C29H31N3O2
InChI:InChI=1/C29H31N3O2/c1-21-8-13-28-25(18-21)27-19-26(23-9-11-24(33-2)12-10-23)30-32(27)29(34-28)14-16-31(17-15-29)20-22-6-4-3-5-7-22/h3-13,18,27H,14-17,19-20H2,1-2H3
SMILES:Cc1ccc2c(c1)C1CC(=NN1C1(CCN(CC1)Cc1ccccc1)O2)c1ccc(cc1)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Morellic acid
CAS:Formula:C33H36O8Purity:(HPLC) ≥ 98.0%Color and Shape:Orange to brown powderMolecular weight:560.64Morellic acid
CAS:Morellic acid has anti-cancer activity, it strongly inhibited the migration of HUVEC at a low concentration of 0.5 µM in HUVEC cell migration assay in vitro. Morellic acid also has antiangiogenic activity.Formula:C33H36O8Purity:95%~99%Color and Shape:PowderMolecular weight:560.643Morellic acid
CAS:Morellic acid inhibits HUVEC migration at 0.5 μM and has anti-cancer and antiangiogenic properties.Formula:C33H36O8Purity:99.43% - 99.85%Color and Shape:SolidMolecular weight:560.63Ref: TM-TN1112
1mg86.00€5mg173.00€10mg295.00€25mg497.00€50mg710.00€100mg973.00€1mL*10mM (DMSO)230.00€Morellic acid
CAS:Oxygen-heterocyclic compoundFormula:C33H36O8Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:560.63Morellic acid
CAS:Morellic acid is a naturally occurring compound that is classified as an organic acid, specifically a depsidone. It is derived primarily from the lichen species of the Parmelia genus. Lichens are symbiotic associations between fungi and photosynthetic organisms, typically algae or cyanobacteria, found in a variety of environmental conditions.Purity:Min. 95%






