CAS 53059-28-2

4'-methoxybiphenyl-3-amine

Description:

4'-Methoxybiphenyl-3-amine, with the CAS number 53059-28-2, is an organic compound characterized by its biphenyl structure substituted with a methoxy group and an amino group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its solubility in organic solvents, while the amino group can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The compound's molecular structure contributes to its electronic properties, which may influence its reactivity and interactions with other chemical species. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₃NO

InChI: InChI=1/C13H13NO/c1-15-13-7-5-10(6-8-13)11-3-2-4-12(14)9-11/h2-9H,14H2,1H3

SMILES: COc1ccc(cc1)c1cccc(c1)N

Synonyms:

• [1,1'-Biphenyl]-3-amine, 4'-methoxy-

4'-Methoxybiphenyl-3-ylamine

CAS: 53059-28-2

Formula: C₁₃H₁₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.2484

Ref: IN-DA00DAEU

4′-Methoxy[1,1′-biphenyl]-3-amine

CAS: 53059-28-2

4′-Methoxy[1,1′-biphenyl]-3-amine

Purity: 97%

Molecular weight: 199.25g/mol

Ref: 54-OR1034725

4′-Methoxybiphenyl-3-ylamine

CAS: 53059-28-2

Formula: C₁₃H₁₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.253

Ref: 10-F014343