CAS 53064-56-5
:5-Isopropyl-3-isoxazolecarbonyl chloride
Description:
5-Isopropyl-3-isoxazolecarbonyl chloride is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features an isopropyl group, contributing to its hydrophobic characteristics, and a carbonyl chloride functional group, which makes it reactive and useful in various synthetic applications. The presence of the carbonyl chloride indicates that it can participate in nucleophilic substitution reactions, making it valuable in organic synthesis, particularly in the formation of amides or esters. The isoxazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. Additionally, the compound's reactivity and structural features may influence its solubility and stability under different conditions. As with many chlorinated compounds, appropriate safety measures should be taken when handling it due to potential hazards associated with the carbonyl chloride group. Overall, 5-Isopropyl-3-isoxazolecarbonyl chloride is a versatile intermediate in chemical synthesis with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H8ClNO2
InChI:InChI=1/C7H8ClNO2/c1-4(2)6-3-5(7(8)10)9-11-6/h3-4H,1-2H3
SMILES:CC(C)c1cc(C(=O)Cl)no1
Synonyms:- 3-Isoxazolecarbonyl Chloride, 5-(1-Methylethyl)-
- 5-(Propan-2-Yl)-1,2-Oxazole-3-Carbonyl Chloride
- 5-Isopropyl-1,2-oxazole-3-carbonyl chloride
- 5-Isopropylisoxazole-3-Carbonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Isopropylisoxazole-3-carbonyl chloride
CAS:<p>5-Isopropylisoxazole-3-carbonyl chloride is a colorless to light yellow liquid that is soluble in organic solvents. It is used as a reagent, speciality chemical, or intermediate for the preparation of other chemicals. 5-Isopropylisoxazole-3-carbonyl chloride has been used in the synthesis of a variety of biologically active compounds, including pharmaceuticals and agrochemicals. This compound can be used as a building block for more complex molecules in both organic synthesis and biochemistry. 5-Isopropylisoxazole-3-carbonyl chloride has also been shown to have inhibitory effects on protein kinase C (PKC) and DNA topoisomerases I and II.</p>Formula:C7H8ClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:173.6 g/mol
