CAS 53064-58-7
:5-cyclopropylisoxazole-3-carbonyl chloride
Description:
5-Cyclopropylisoxazole-3-carbonyl chloride is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of the cyclopropyl group contributes to its distinctive properties, influencing its reactivity and potential applications in organic synthesis. As a carbonyl chloride, it features a reactive acyl chloride functional group, making it useful in acylation reactions and the synthesis of various derivatives. This compound is typically utilized in medicinal chemistry and the development of pharmaceuticals due to its ability to serve as an intermediate in the synthesis of biologically active molecules. Its reactivity can be attributed to the electrophilic nature of the carbonyl carbon, which can readily participate in nucleophilic attack. Additionally, the compound's stability and solubility characteristics may vary depending on the solvent and conditions used in reactions. Overall, 5-cyclopropylisoxazole-3-carbonyl chloride is a valuable compound in synthetic organic chemistry, particularly in the context of drug discovery and development.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c8-7(10)5-3-6(11-9-5)4-1-2-4/h3-4H,1-2H2
SMILES:C1CC1c1cc(C(=O)Cl)no1
Synonyms:- 3-Isoxazolecarbonyl Chloride, 5-Cyclopropyl-
- 5-Cyclopropyl-1,2-Oxazole-3-Carbonyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.