CAS 53065-47-7

4-isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol

Description:

4-Isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol, with the CAS number 53065-47-7, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance features a mercapto group (-SH) and an isopropyl group, contributing to its unique chemical properties. It is characterized by its potential applications in agricultural chemistry, particularly as a fungicide or plant growth regulator, due to its ability to interact with biological systems. The presence of the hydroxyl (-OH) group enhances its solubility in polar solvents, while the mercapto group can participate in redox reactions, making it a versatile compound in synthetic chemistry. Additionally, its structure allows for various modifications, which can lead to derivatives with altered biological activity. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₅H₉N₃OS

InChI: InChI=1/C5H9N3OS/c1-3(2)8-4(9)6-7-5(8)10/h3H,1-2H3,(H,6,9)(H,7,10)

SMILES: CC(C)n1c(nnc1S)O

Synonyms:

• 4-(1-Methylethyl)-5-Thioxo-1,2,4-Triazolidin-3-One

4-Isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol

CAS: 53065-47-7

Formula: C₅H₉N₃OS

Purity: 95%

Molecular weight: 159.2095

Ref: IN-DA00D85D

5-Hydroxy-4-isopropyl-3-sulphanyl-4H-1,2,4-triazole

CAS: 53065-47-7

5-Hydroxy-4-isopropyl-3-sulphanyl-4H-1,2,4-triazole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 159.21g/mol

Ref: 54-OR29581

4-Isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol

CAS: 53065-47-7

Formula: C₅H₉N₃OS

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 159.21

Ref: 10-F068985