CAS 5308-28-1
:N-Isobutyliperazine
Description:
N-Isobutylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an isobutyl group attached to one of the nitrogen atoms, contributing to its unique properties. N-Isobutylpiperazine is typically a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in organic solvents and exhibits moderate polarity. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. Its structure allows for potential interactions with biological targets, making it a subject of research in drug development. Additionally, N-Isobutylpiperazine may exhibit basic properties due to the presence of the piperazine nitrogen atoms, which can participate in protonation reactions. Safety data indicates that, like many amines, it should be handled with care due to potential irritant effects on the skin and respiratory system.
Formula:C8H18N2
InChI:InChI=1/C8H18N2/c1-8(2)7-10-5-3-9-4-6-10/h8-9H,3-7H2,1-2H3
SMILES:CC(C)CN1CCNCC1
Synonyms:- N-Isobutylpiperazine
- 1-(2-Methylpropyl)Piperazinediium
- 1-(2-Methylpropyl)Piperazine
- 1-Isobutyl-piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(2-Methylpropyl)piperazine
CAS:Formula:C8H18N2Purity:98%Color and Shape:LiquidMolecular weight:142.2461-Isobutylpiperazine
CAS:Controlled Product1-Isobutylpiperazine is a synthetic amino acid that has been shown to have anticancer, antiviral, and anti-inflammatory properties. It is an inhibitor of the enzyme sulfatase, which is responsible for the degradation of sulfated glycosaminoglycans in the body. 1-Isobutylpiperazine has also been shown to be effective in treating heart disease and aminophenyl (AP) toxicity. AP overdose can lead to severe muscle spasms and seizures. 1-Isobutylpiperazine prevents AP from binding to sulfamate receptors on cells, which prevents cell death. Treatment with 1-isobutylpiperazine also reduces inflammation by inhibiting inflammatory cytokines such as tumor necrosis factor alpha (TNFα) and interleukin-1β (IL-1β). This drug also has potential use in treating autoimmune diseases or infectious diseases by modulating the immune system.Formula:C8H18N2Purity:Min. 95%Molecular weight:142.24 g/mol


