CAS 5309-35-3

N'-(3-bromobenzylidene)-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidine-2-carbohydrazide

Description:

N'-(3-bromobenzylidene)-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidine-2-carbohydrazide is a complex organic compound characterized by its unique structural features, which include a benzothieno-pyrimidine core and a hydrazide functional group. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the bromobenzylidene moiety suggests potential reactivity and interactions with biological targets. Its hexahydro structure indicates saturation, which may influence its solubility and stability. The compound's hydrazide group can participate in various chemical reactions, including hydrazone formation and potential interactions with biomolecules. Additionally, the presence of multiple functional groups may contribute to its pharmacological properties, including antibacterial or anticancer activities. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential in various fields of research.

Formula: C₁₈H₁₅BrN₄O₂S

InChI: InChI=1/C18H15BrN4O2S/c19-11-5-3-4-10(8-11)9-20-23-17(25)15-21-16(24)14-12-6-1-2-7-13(12)26-18(14)22-15/h3-5,8-9H,1-2,6-7H2,(H,23,25)(H,21,22,24)

SMILES: C1CCc2c(C1)c1c(nc(C(=O)NN=Cc3cccc(c3)Br)nc1s2)O

9,13-Epidioxy-8(14)-abieten-18-oic acid

CAS: 5309-35-3

9,13β-Epidioxy-8(14)-abieten-18-oic acid has anti-inflammatory activities, it exhibits moderate activities on NO levels in LPS-stimulated murine microglia BV2

Formula: C₂₀H₃₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 334.45

Ref: TM-T5157

9β,13β-Epidioxyabiet-8(14)-en-18-oic acid

CAS: 5309-35-3

Formula: C₂₀H₃₀O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 334.456

Ref: BP-SBP00502

9,13-Epidioxy-8(14)-abieten-18-oic acid

CAS: 5309-35-3

9,13-Epidioxy-8(14)-abieten-18-oic acid is a naturally occurring diterpene compound, which is derived from the resin of certain pine species. Its unique structure includes an epidioxy bridge, which is a key feature contributing to its biological activity. The compound acts primarily through its ability to generate reactive oxygen species, leading to oxidative stress that can target microbial cells and tumor cells alike. This mechanism makes it a promising candidate for antimicrobial and antitumor applications. It has been studied for its potential to inhibit the growth of various pathogenic microorganisms and its ability to induce apoptosis in cancerous cells. The compound is often explored within the context of drug discovery and development, particularly for its role in novel therapeutic strategies aimed at resistant strains of bacteria and challenging cancer types. Researchers continue to investigate its pharmacokinetic properties and potential synergistic effects with other bioactive compounds.

Formula: C₂₀H₃₀O₄

Purity: Min. 95%

Molecular weight: 334.4 g/mol

Ref: 3D-FAA30935