CAS 531-55-5
:Azure B
Description:
Azure B, with the CAS number 531-55-5, is a synthetic dye belonging to the phenothiazine family. It is characterized by its vibrant blue color and is commonly used in biological staining, particularly in histology and microbiology, to visualize cellular structures. Azure B exhibits solubility in water and organic solvents, making it versatile for various applications. The compound has a molecular formula that reflects its complex structure, which includes a phenothiazine core. Azure B is known for its ability to bind to nucleic acids, which is why it is often employed in staining procedures to highlight DNA and RNA in cells. Additionally, it has been studied for its potential applications in photodynamic therapy due to its light-absorbing properties. However, safety considerations are important, as it may pose health risks if not handled properly, necessitating the use of appropriate protective measures during its use in laboratory settings.
Formula:C15H16N3S·Cl
InChI:InChI=1S/C15H16N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16H,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=KFZNPGQYVZZSNV-UHFFFAOYSA-M
SMILES:N(C)(C)C1=CC2=C(N=C3C(=[S+]2)C=C(NC)C=C3)C=C1.[Cl-]
Synonyms:- 3-(Dimethylamino)-7-(Methylamino)Phenothiazin-5-Ium Chloride
- 3-Methylamino-7-dimethylaminophenazathionium chloride
- Azur I
- Azure B
- Azure B chloride
- Methylene Azure
- N-methyl-N-[7-(methylamino)-3H-phenothiazin-3-ylidene]methanaminium chloride
- Phenothiazin-5-ium, 3-(dimethylamino)-7-(methylamino)-, chloride
- Phenothiazin-5-ium, 3-(dimethylamino)-7-(methylamino)-, chloride (1:1)
- Trimethylthionine
- Trimethylthionine chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
Azure I
CAS:Azure B is used for staining semi-thin sections of plant tissue. This dye is also useful in the NCCLS method for blood smears and Lillie's modified Nocht's method for paraffin sections. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some docum
Formula:C15H16ClN3SColor and Shape:Powder, Dark green or brown to blackMolecular weight:305.82Azure B (3-(Dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride)
CAS:Basic dyes and preparations based thereonFormula:C15H16ClN3SColor and Shape:Dark Green PowderMolecular weight:305.07535Azure B
CAS:Azure B (Azure B chloride) is a cationic dye and the major metabolite of Methylene blue.Formula:C15H16ClN3SPurity:98%Color and Shape:Dark Green Crystalline PowderMolecular weight:305.83Azure B (C.I. 52010)
CAS:Formula:C15H16ClN3SPurity:(spectrophotometry) ≥ 75.0%Color and Shape:Brown to dark green or black powderMolecular weight:305.833-(Dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride
CAS:Purity:81.0%Color and Shape:Solid, Green crystalline powderMolecular weight:305.82000732421875Azure B (Technical Grade)
CAS:Controlled ProductApplications Azure B is a dye used for staining semi-thin sections of plant tissues. Azure B is used for staining semi-thin sections of plant tissue. This dye is also useful in the NCCLS method for blood smears and Lillie's modified Nocht's method for paraffin sections. Dyes and metabolites.
References 1. Penney, D.P., et al. 2002. Biotech. Histochem. 77: 237-275. PMID: 12564600Formula:C15H16N3S·ClColor and Shape:Dark GreenMolecular weight:305.83Azure B
CAS:Azure B is a triiodide compound that has been used as an analytical reagent. It reacts with potassium dichromate to produce methylene, which is then absorbed by the skin. Azure B has been used as a skin cancer diagnostic tool and has shown inhibition of cell division in human serum and cell nuclei. Azure B can be used for the treatment of wastewater containing toxic substances such as industrial waste or agricultural runoff from farms. The use of Azure B does not cause any adverse effects on the environment or human health, making it an environmentally friendly alternative to other chemical treatments for wastewater.Formula:C15H16ClN3SColor and Shape:Green PowderMolecular weight:305.83 g/molAzure B (Azure I)
CAS:Formula:C15H16ClN3SColor and Shape:Dark green to Brown to Black, Crystalline powderMolecular weight:305.83











