CAS 5310-10-1

Ethanethioamide, N-methyl-

Description:

Ethanethioamide, N-methyl- is an organic compound characterized by its amide functional group, specifically featuring a methyl group attached to the nitrogen atom. Its molecular structure consists of a thioamide group, which includes a sulfur atom bonded to a carbonyl carbon, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in polar solvents, reflecting its polar nature due to the presence of the amide group. Ethanethioamide, N-methyl- is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many thioamides, it should be handled with care due to potential toxicity and irritant properties. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.

Formula: C₃H₇NS

InChI: InChI=1S/C3H7NS/c1-3(5)4-2/h1-2H3,(H,4,5)

InChI key: InChIKey=BNLLHLUAOXAUNQ-UHFFFAOYSA-N

SMILES: C(NC)(C)=S

Synonyms:

• Acetamide, N-methylthio-
• Methanethioamide, Dimethyl-
• Methylthioacetamide
• N-methylthioacetamide
• ethanethioamide, N-methyl-
• N-Methylethanethioamide

N-Methylethanethioamide

CAS: 5310-10-1

N-Methylethanethioamide

Purity: ≥95%

Color and Shape: Pale Yellow Solid

Molecular weight: 89.16g/mol

Ref: 54-OR322821