CAS 5310-14-5
:N-Methylbenzenecarbothioamide
Description:
N-Methylbenzenecarbothioamide, with the CAS number 5310-14-5, is an organic compound characterized by the presence of a thioamide functional group. This compound features a methyl group attached to the nitrogen of the thioamide, along with a phenyl group, which contributes to its aromatic properties. The thioamide group (-C(S)NH-) is known for its reactivity, particularly in nucleophilic substitution reactions and as a potential ligand in coordination chemistry. N-Methylbenzenecarbothioamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure. Its chemical properties can be influenced by the presence of the sulfur atom, which can participate in various chemical reactions, including those involving electrophiles. Additionally, this compound may have applications in organic synthesis and medicinal chemistry, given the importance of thioamide derivatives in drug development and as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H9NS
InChI:InChI=1S/C8H9NS/c1-9-8(10)7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10)
InChI key:InChIKey=VXQROEXTWNTASQ-UHFFFAOYSA-N
SMILES:C(NC)(=S)C1=CC=CC=C1
Synonyms:- Benzamide, N-methylthio-
- N-Methylthiobenzamide
- NSC 525270
- benzenecarbothioamide, N-methyl-
- N-Methylbenzenecarbothioamide
- N-Methylbenzenecarbothioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Methylbenzenecarbothioamide
CAS:N-MethylbenzenecarbothioamidePurity:95%Molecular weight:151.23g/molN-Methylbenzenecarbothioamide
CAS:Formula:C8H9NSPurity:95%Color and Shape:Liquid, No data available.Molecular weight:151.23N-Methylbenzenecarbothioamide
CAS:N-Methylbenzenecarbothioamide is a chemical compound that has a molecular weight of 269.3 g/mol, and is a colorless liquid with a boiling point of 115°C. It is soluble in water and alcohols, but insoluble in ether. N-Methylbenzenecarbothioamide has low toxicity to animals when used at sublethal doses. The uptake of this substance by the lungs can be increased by exposure to chloride ions or serotonin. This chemical has shown to have an effect on the central nervous system as well, which may be due to its ability to release serotonin from the presynaptic nerve terminal. N-Methylbenzenecarbothioamide can also form hydrogen bonds with other molecules, including protonated amines, hydroxyl groups, and sulfuric acid groups. This chemical was first synthesized by Emil Fischer in 1894 and was later named "carboxylic acid methyl ester"Formula:C8H9NSPurity:Min. 95%Molecular weight:151.23 g/mol


