CymitQuimica logo

CAS 5310-26-9

:

Benzenecarbothioamide, N-(4-methoxyphenyl)-

Description:
Benzenecarbothioamide, N-(4-methoxyphenyl)-, also known by its CAS number 5310-26-9, is an organic compound characterized by the presence of a thiocarbonamide functional group attached to a benzene ring, with a methoxy-substituted phenyl group. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity and interactions with other chemical species. Benzenecarbothioamide derivatives are often studied for their potential biological activities, including antimicrobial and anticancer properties. The compound's structure allows for various chemical modifications, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C14H13NOS
InChI:InChI=1/C14H13NOS/c1-16-13-9-7-12(8-10-13)15-14(17)11-5-3-2-4-6-11/h2-10H,1H3,(H,15,17)
InChI key:HGBOOZXXUFQBLX-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)NC(=S)C2=CC=CC=C2
Synonyms:
  • Benzenecarbothioamide, N-(4-methoxyphenyl)-
  • N-(4-Methoxyphenyl)benzenecarbothioamide
  • N-(4-methoxyphenyl)benzenecarbothioamide
  • benzenecarbothioamide, N-(4-methoxyphenyl)-
Found 4 products.