CAS 53104-96-4

2-(difluoromethoxy)phenol

Description:

2-(Difluoromethoxy)phenol, with the CAS number 53104-96-4, is an organic compound characterized by the presence of a phenolic group and a difluoromethoxy substituent. This compound typically exhibits a molecular structure that includes a benzene ring bonded to a hydroxyl group (–OH) and a difluoromethoxy group (–O–CF2H). The difluoromethoxy group contributes to the compound's unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. 2-(Difluoromethoxy)phenol may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its functional groups. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the compound. Additionally, the presence of fluorine atoms can influence the compound's stability and reactivity, making it of interest in various fields of research, including medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₆F₂O₂

InChI: InChI=1/C7H6F2O2/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7,10H

SMILES: c1ccc(c(c1)O)OC(F)F

2-(DIFLUOROMETHOXY)PHENOL 98

CAS: 53104-96-4

Formula: C₇H₆F₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 160.1181

Ref: IN-DA00DHXN

2-(Difluoromethoxy)phenol

CAS: 53104-96-4

2-(Difluoromethoxy)phenol

Purity: 97%

Molecular weight: 160.12g/mol

Ref: 54-PC3421

2-(Difluoromethoxy)phenol

CAS: 53104-96-4

Formula: C₇H₆F₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 160.12

Ref: 10-F329928

2-(Difluoromethoxy)Phenol

CAS: 53104-96-4

2-(Difluoromethoxy)Phenol is a purine derivative and pyrimidine derivative. It has been shown to inhibit the growth of cancer cells in vitro and in vivo. 2-(Difluoromethoxy)phenol inhibits multidrug resistance by inhibiting the transport of drugs into cells and thereby preventing their accumulation. As a result, it suppresses inflammatory diseases and autoimmune diseases. The hydroxyl group in this compound can be replaced with fluorine or nitro groups to generate new derivatives with different properties. Piperidine can also be added to this molecule to create an analogue that is more potent than 2-(difluoromethoxy)phenol and has a longer duration of action.

Formula: C₇H₆F₂O₂

Purity: Min. 95%

Molecular weight: 160.12 g/mol

Ref: 3D-FD78013