CAS 53111-25-4

γ-Himachalene

Description:

γ-Himachalene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various plant species, particularly in the essential oils of certain conifers. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and potential applications. γ-Himachalene is known for its distinctive aroma, often described as woody or earthy, making it of interest in the fragrance and flavor industries. The compound exhibits hydrophobic characteristics, which influence its solubility in organic solvents rather than in water. Additionally, γ-Himachalene has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, although further research is needed to fully understand its mechanisms and efficacy. Its stability under various conditions makes it a candidate for use in formulations requiring long-lasting fragrance or therapeutic effects. Overall, γ-Himachalene represents a fascinating subject of study within the field of natural products and organic chemistry, with implications for both industrial and medicinal applications.

Formula: C₁₅H₂₄

InChI: InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h6,10,13-14H,5,7-9H2,1-4H3/t13-,14-/m0/s1

InChI key: InChIKey=PUWNTRHCKNHSAT-KBPBESRZSA-N

SMILES: CC1(C)[C@@]2([C@](C(C)=CCC1)(CCC(C)=C2)[H])[H]

Synonyms:

• (-)-γ-Himachalene
• (4aS,9aR)-2,4a,5,6,7,9a-Hexahydro-3,5,5,9-tetramethyl-1H-benzocycloheptene
• 1H-Benzocycloheptene, 2,4a,5,6,7,9a-hexahydro-3,5,5,9-tetramethyl-, (4aS,9aR)-
• 1H-Benzocycloheptene, 2,4a,5,6,7,9a-hexahydro-3,5,5,9-tetramethyl-, (4aS-cis)-
• γ-cis-Himachalene

γ-Himachalene

CAS: 53111-25-4

Gamma-Himachalene is a sesquiterpene hydrocarbon, which is primarily sourced from the essential oils of certain plants, such as cedarwood. As a naturally occurring compound, its biosynthesis within the plant involves the cyclization of isoprenoid units, which gives rise to its unique chemical structure. This process is typically mediated by enzymes that facilitate the formation of various terpene compounds.

Formula: C₁₅H₂₄

Purity: Min. 95%

Molecular weight: 204.35 g/mol

Ref: 3D-FH157326