CAS 53119-66-7

2,4-Dibromo-3-methylthiophene

Description:

2,4-Dibromo-3-methylthiophene is a heterocyclic organic compound characterized by a five-membered aromatic ring containing sulfur. The presence of bromine substituents at the 2 and 4 positions, along with a methylthio group at the 3 position, contributes to its unique chemical properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents. Its molecular structure allows for potential reactivity in electrophilic substitution reactions due to the electron-withdrawing nature of the bromine atoms. Additionally, the thiophene ring can participate in various chemical transformations, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound's physical properties, such as melting and boiling points, are influenced by its molecular interactions and substituents. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,4-Dibromo-3-methylthiophene is an important compound in the field of organic chemistry with diverse applications.

Formula: C₅H₄Br₂S

InChI: InChI=1S/C5H4Br2S/c1-3-4(6)2-8-5(3)7/h2H,1H3

InChI key: InChIKey=XLFOWVGHYFPKMU-UHFFFAOYSA-N

SMILES: CC=1C(Br)=CSC1Br

Synonyms:

• Thiophene, 2,4-dibromo-3-methyl-
• 2,4-Dibromo-3-methylthiophene

2,4-Dibromo-3-methylthiophene

CAS: 53119-66-7

Versatile small molecule scaffold

Formula: C₅H₄Br₂S

Purity: Min. 95%

Molecular weight: 255.96 g/mol

Ref: 3D-DCA11966