CAS 53130-46-4

2,5-Bis(trifluoromethyl)benzamide

Description:

2,5-Bis(trifluoromethyl)benzamide is an organic compound characterized by the presence of two trifluoromethyl groups attached to a benzamide structure. This compound features a benzene ring substituted at the 2 and 5 positions with trifluoromethyl groups (–CF3), which are known for their strong electron-withdrawing properties. The amide functional group (–C(O)NH2) contributes to the compound's potential reactivity and solubility in various solvents. The presence of multiple fluorine atoms enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the trifluoromethyl groups can impart unique physical properties, such as increased thermal stability and altered volatility. Overall, 2,5-Bis(trifluoromethyl)benzamide is a fluorinated aromatic compound that may exhibit distinctive chemical behavior due to its structural features, making it valuable for various applications in synthetic chemistry and material science.

Formula: C₉H₅F₆NO

InChI: InChI=1S/C9H5F6NO/c10-8(11,12)4-1-2-6(9(13,14)15)5(3-4)7(16)17/h1-3H,(H2,16,17)

InChI key: InChIKey=OYXFWPXMRHRCTB-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(C(F)(F)F)C=CC(C(F)(F)F)=C1

Synonyms:

• Benzamide, 2,5-Bis(Trifluoromethyl)-
• Fxffr Bvz Dxfff
• 2,5-Bis(trifluoromethyl)benzamide

2,5-Bis(trifluoromethyl)benzamide

CAS: 53130-46-4

2,5-Bis(trifluoromethyl)benzamide

Formula: C₉H₅F₆NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.13g/mol

Ref: 54-PC302377